C16H14N4O3 — CID 689131
[4-[(4R)-6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]phenyl] acetate (PubChem CID 689131) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is [4-[(4R)-6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]phenyl] acetate.
| Compound Name | [4-[(4R)-6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 689131 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [4-[(4R)-6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@@H]2C(C#N)=C(N)Oc3n[nH]c(C)c32)cc1 |
| InChI | InChI=1S/C16H14N4O3/c1-8-13-14(10-3-5-11(6-4-10)22-9(2)21)12(7-17)15(18)23-16(13)20-19-8/h3-6,14H,18H2,1-2H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | UJYDXGKMPAMBMG-CQSZACIVSA-N |
| XLogP | 1.86 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|