C21H14Cl2N4O3 — CID 4033915
[4-(6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)phenyl] 3,4-dichlorobenzoate (PubChem CID 4033915) has the molecular formula C21H14Cl2N4O3 and a molecular weight of 441.27 g/mol. Its IUPAC name is [4-(6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)phenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-(6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)phenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4033915 |
| Molecular Formula | C21H14Cl2N4O3 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | [4-(6-amino-5-cyano-3-methyl-2,4-dihydropyrano[2,3-c]pyrazol-4-yl)phenyl] 3,4-dichlorobenzoate |
| SMILES | Cc1[nH]nc2c1C(c1ccc(OC(=O)c3ccc(Cl)c(Cl)c3)cc1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C21H14Cl2N4O3/c1-10-17-18(14(9-24)19(25)30-20(17)27-26-10)11-2-5-13(6-3-11)29-21(28)12-4-7-15(22)16(23)8-12/h2-8,18H,25H2,1H3,(H,26,27) |
| InChIKey | IUCGHGGDIGZZRX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|