C17H28O6 — CID 68914350
1-O-(2,3-dihydroxypropyl) 4-O-(5-methyl-2-propan-2-ylcyclohexyl) but-2-enedioate (PubChem CID 68914350) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-O-(2,3-dihydroxypropyl) 4-O-(5-methyl-2-propan-2-ylcyclohexyl) but-2-enedioate.
| Compound Name | 1-O-(2,3-dihydroxypropyl) 4-O-(5-methyl-2-propan-2-ylcyclohexyl) but-2-enedioate |
|---|---|
| PubChem CID | 68914350 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-O-(2,3-dihydroxypropyl) 4-O-(5-methyl-2-propan-2-ylcyclohexyl) but-2-enedioate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C=CC(=O)OCC(O)CO)C1 |
| InChI | InChI=1S/C17H28O6/c1-11(2)14-5-4-12(3)8-15(14)23-17(21)7-6-16(20)22-10-13(19)9-18/h6-7,11-15,18-19H,4-5,8-10H2,1-3H3 |
| InChIKey | KGCRVMWGXPOIDN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|