C24H34N6O2 — CID 68914629
1-[2-amino-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]nonane-1,9-diamine (PubChem CID 68914629) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-[2-amino-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]nonane-1,9-diamine.
| Compound Name | 1-[2-amino-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]nonane-1,9-diamine |
|---|---|
| PubChem CID | 68914629 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-[2-amino-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]nonane-1,9-diamine |
| SMILES | COc1ccc(-c2ccc3nc(N)nc(C(N)CCCCCCCCN)c3n2)cc1OC |
| InChI | InChI=1S/C24H34N6O2/c1-31-20-13-10-16(15-21(20)32-2)18-11-12-19-23(28-18)22(30-24(27)29-19)17(26)9-7-5-3-4-6-8-14-25/h10-13,15,17H,3-9,14,25-26H2,1-2H3,(H2,27,29,30) |
| InChIKey | LFNJGCATUIYHEB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|