C18H20Cl2N4O3 — CID 68914756
5-(2-oxo-2-piperidin-4-ylethyl)-2H-pyrido[4,3-c][1,6]naphthyridine-1,6-dione;dihydrochloride (PubChem CID 68914756) has the molecular formula C18H20Cl2N4O3 and a molecular weight of 411.29 g/mol. Its IUPAC name is 5-(2-oxo-2-piperidin-4-ylethyl)-2H-pyrido[4,3-c][1,6]naphthyridine-1,6-dione;dihydrochloride.
| Compound Name | 5-(2-oxo-2-piperidin-4-ylethyl)-2H-pyrido[4,3-c][1,6]naphthyridine-1,6-dione;dihydrochloride |
|---|---|
| PubChem CID | 68914756 |
| Molecular Formula | C18H20Cl2N4O3 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 5-(2-oxo-2-piperidin-4-ylethyl)-2H-pyrido[4,3-c][1,6]naphthyridine-1,6-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cn1c(=O)c2ccncc2c2c(=O)[nH]ccc21)C1CCNCC1 |
| InChI | InChI=1S/C18H18N4O3.2ClH/c23-15(11-1-5-19-6-2-11)10-22-14-4-8-21-17(24)16(14)13-9-20-7-3-12(13)18(22)25;;/h3-4,7-9,11,19H,1-2,5-6,10H2,(H,21,24);2*1H |
| InChIKey | IIOUAFLDPRRZMP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|