C22H17F6N5O3 — CID 161463609
1,1,1,4,4,4-hexafluorobutane-2,3-dione;4-piperidin-4-yl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one (PubChem CID 161463609) has the molecular formula C22H17F6N5O3 and a molecular weight of 513.40 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;4-piperidin-4-yl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;4-piperidin-4-yl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one |
|---|---|
| PubChem CID | 161463609 |
| Molecular Formula | C22H17F6N5O3 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;4-piperidin-4-yl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.O=c1[nH]ccc2c1c1cnccc1c1nc(C3CCNCC3)cn21 |
| InChI | InChI=1S/C18H17N5O.C4F6O2/c24-18-16-13-9-20-7-3-12(13)17-22-14(11-1-5-19-6-2-11)10-23(17)15(16)4-8-21-18;5-3(6,7)1(11)2(12)4(8,9)10/h3-4,7-11,19H,1-2,5-6H2,(H,21,24); |
| InChIKey | WCDGIMXCRISMFW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|