C19H20N4O2S — CID 87508485
2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]amino]-9H-[1,3]thiazolo[5,4-f][2,9]phenanthrolin-8-one (PubChem CID 87508485) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]amino]-9H-[1,3]thiazolo[5,4-f][2,9]phenanthrolin-8-one.
| Compound Name | 2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]amino]-9H-[1,3]thiazolo[5,4-f][2,9]phenanthrolin-8-one |
|---|---|
| PubChem CID | 87508485 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]amino]-9H-[1,3]thiazolo[5,4-f][2,9]phenanthrolin-8-one |
| SMILES | CC(C)(C)[C@@H](CO)Nc1nc2c3ccncc3c3c(=O)[nH]ccc3c2s1 |
| InChI | InChI=1S/C19H20N4O2S/c1-19(2,3)13(9-24)22-18-23-15-10-4-6-20-8-12(10)14-11(16(15)26-18)5-7-21-17(14)25/h4-8,13,24H,9H2,1-3H3,(H,21,25)(H,22,23)/t13-/m1/s1 |
| InChIKey | WFBIKAKMTNPGGC-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|