C21H16F6N4O3 — CID 157357641
4-tert-butyl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 157357641) has the molecular formula C21H16F6N4O3 and a molecular weight of 486.37 g/mol. Its IUPAC name is 4-tert-butyl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 4-tert-butyl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 157357641 |
| Molecular Formula | C21H16F6N4O3 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 4-tert-butyl-2,5,10,15-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,16-heptaen-14-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | CC(C)(C)c1cn2c3cc[nH]c(=O)c3c3cnccc3c2n1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H16N4O.C4F6O2/c1-17(2,3)13-9-21-12-5-7-19-16(22)14(12)11-8-18-6-4-10(11)15(21)20-13;5-3(6,7)1(11)2(12)4(8,9)10/h4-9H,1-3H3,(H,19,22); |
| InChIKey | BIGVTHYJTUGPGM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|