C20H12F3N5O — CID 59375661
4-(2-pyridin-3-ylethynyl)-6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one (PubChem CID 59375661) has the molecular formula C20H12F3N5O and a molecular weight of 395.34 g/mol. Its IUPAC name is 4-(2-pyridin-3-ylethynyl)-6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one.
| Compound Name | 4-(2-pyridin-3-ylethynyl)-6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59375661 |
| Molecular Formula | C20H12F3N5O |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 4-(2-pyridin-3-ylethynyl)-6-(2,2,2-trifluoroethylamino)-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
| SMILES | O=c1[nH]cc(C#Cc2cccnc2)c2nc(NCC(F)(F)F)c3ccncc3c12 |
| InChI | InChI=1S/C20H12F3N5O/c21-20(22,23)11-27-18-14-5-7-25-10-15(14)16-17(28-18)13(9-26-19(16)29)4-3-12-2-1-6-24-8-12/h1-2,5-10H,11H2,(H,26,29)(H,27,28) |
| InChIKey | KGQFIRHIVCSGIQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|