C22H29N3O3S — CID 68915669
3,3-dimethyl-N-(4-methylsulfonylanilino)-2-oxo-N'-(4-propan-2-ylphenyl)butanimidamide (PubChem CID 68915669) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 3,3-dimethyl-N-(4-methylsulfonylanilino)-2-oxo-N'-(4-propan-2-ylphenyl)butanimidamide.
| Compound Name | 3,3-dimethyl-N-(4-methylsulfonylanilino)-2-oxo-N'-(4-propan-2-ylphenyl)butanimidamide |
|---|---|
| PubChem CID | 68915669 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3,3-dimethyl-N-(4-methylsulfonylanilino)-2-oxo-N'-(4-propan-2-ylphenyl)butanimidamide |
| SMILES | CC(C)c1ccc(/N=C(/NNc2ccc(S(C)(=O)=O)cc2)C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29N3O3S/c1-15(2)16-7-9-17(10-8-16)23-21(20(26)22(3,4)5)25-24-18-11-13-19(14-12-18)29(6,27)28/h7-15,24H,1-6H3,(H,23,25) |
| InChIKey | OFPIJUJHGOUBFI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|