C19H21Cl2N3O — CID 16718486
N-(4-chloroanilino)-N'-(4-chlorophenyl)-4,4-dimethyl-2-oxopentanimidamide (PubChem CID 16718486) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is N-(4-chloroanilino)-N'-(4-chlorophenyl)-4,4-dimethyl-2-oxopentanimidamide.
| Compound Name | N-(4-chloroanilino)-N'-(4-chlorophenyl)-4,4-dimethyl-2-oxopentanimidamide |
|---|---|
| PubChem CID | 16718486 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(4-chloroanilino)-N'-(4-chlorophenyl)-4,4-dimethyl-2-oxopentanimidamide |
| SMILES | CC(C)(C)CC(=O)/C(=N\c1ccc(Cl)cc1)NNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2N3O/c1-19(2,3)12-17(25)18(22-15-8-4-13(20)5-9-15)24-23-16-10-6-14(21)7-11-16/h4-11,23H,12H2,1-3H3,(H,22,24) |
| InChIKey | VPIHTJSWJMGFBK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|