C37H28Br2Cl2N6O3 — CID 174548024
1-N',5-N'-bis(4-bromophenyl)-1-N,5-N-bis(4-chloroanilino)-2,4-bis(furan-2-yl)-3-oxopentanediimidamide (PubChem CID 174548024) has the molecular formula C37H28Br2Cl2N6O3 and a molecular weight of 835.38 g/mol. Its IUPAC name is 1-N',5-N'-bis(4-bromophenyl)-1-N,5-N-bis(4-chloroanilino)-2,4-bis(furan-2-yl)-3-oxopentanediimidamide.
| Compound Name | 1-N',5-N'-bis(4-bromophenyl)-1-N,5-N-bis(4-chloroanilino)-2,4-bis(furan-2-yl)-3-oxopentanediimidamide |
|---|---|
| PubChem CID | 174548024 |
| Molecular Formula | C37H28Br2Cl2N6O3 |
| Molecular Weight | 835.38 g/mol |
| Exact Mass | 832.00 |
| IUPAC Name | 1-N',5-N'-bis(4-bromophenyl)-1-N,5-N-bis(4-chloroanilino)-2,4-bis(furan-2-yl)-3-oxopentanediimidamide |
| SMILES | O=C(C(/C(=N/c1ccc(Br)cc1)NNc1ccc(Cl)cc1)c1ccco1)C(/C(=N/c1ccc(Br)cc1)NNc1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C37H28Br2Cl2N6O3/c38-23-5-13-27(14-6-23)42-36(46-44-29-17-9-25(40)10-18-29)33(31-3-1-21-49-31)35(48)34(32-4-2-22-50-32)37(43-28-15-7-24(39)8-16-28)47-45-30-19-11-26(41)12-20-30/h1-22,33-34,44-45H,(H,42,46)(H,43,47) |
| InChIKey | XUTFEQIYCPTNJW-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.38 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|