C20H18Cl2N4O3 — CID 175698567
N'-(4-chlorophenyl)-4-(4-chlorophenyl)imino-4-(3-hydroxy-5-oxo-1,2-dihydropyrrol-4-yl)butanehydrazide (PubChem CID 175698567) has the molecular formula C20H18Cl2N4O3 and a molecular weight of 433.30 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-4-(4-chlorophenyl)imino-4-(3-hydroxy-5-oxo-1,2-dihydropyrrol-4-yl)butanehydrazide.
| Compound Name | N'-(4-chlorophenyl)-4-(4-chlorophenyl)imino-4-(3-hydroxy-5-oxo-1,2-dihydropyrrol-4-yl)butanehydrazide |
|---|---|
| PubChem CID | 175698567 |
| Molecular Formula | C20H18Cl2N4O3 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N'-(4-chlorophenyl)-4-(4-chlorophenyl)imino-4-(3-hydroxy-5-oxo-1,2-dihydropyrrol-4-yl)butanehydrazide |
| SMILES | O=C(CC/C(=N\c1ccc(Cl)cc1)C1=C(O)CNC1=O)NNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N4O3/c21-12-1-5-14(6-2-12)24-16(19-17(27)11-23-20(19)29)9-10-18(28)26-25-15-7-3-13(22)4-8-15/h1-8,25,27H,9-11H2,(H,23,29)(H,26,28)/b24-16+ |
| InChIKey | GXHYJWLPGVKMQU-LFVJCYFKSA-N |
| XLogP | 3.93 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|