C20H19N5O — CID 68913055
N-(4-cyanoanilino)-N'-(4-cyanophenyl)-3,3-dimethyl-2-oxobutanimidamide (PubChem CID 68913055) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is N-(4-cyanoanilino)-N'-(4-cyanophenyl)-3,3-dimethyl-2-oxobutanimidamide.
| Compound Name | N-(4-cyanoanilino)-N'-(4-cyanophenyl)-3,3-dimethyl-2-oxobutanimidamide |
|---|---|
| PubChem CID | 68913055 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(4-cyanoanilino)-N'-(4-cyanophenyl)-3,3-dimethyl-2-oxobutanimidamide |
| SMILES | CC(C)(C)C(=O)/C(=N\c1ccc(C#N)cc1)NNc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H19N5O/c1-20(2,3)18(26)19(23-16-8-4-14(12-21)5-9-16)25-24-17-10-6-15(13-22)7-11-17/h4-11,24H,1-3H3,(H,23,25) |
| InChIKey | FQUJIGFFDJVMSZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|