C25H25ClN2O5S2 — CID 68915810
methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate (PubChem CID 68915810) has the molecular formula C25H25ClN2O5S2 and a molecular weight of 533.07 g/mol. Its IUPAC name is methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate.
| Compound Name | methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 68915810 |
| Molecular Formula | C25H25ClN2O5S2 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate |
| SMILES | COC(=O)CCc1cnc(C[C@@H]2S[C@@H](c3cccc(OC)c3OC)c3cc(Cl)ccc3NC2=O)s1 |
| InChI | InChI=1S/C25H25ClN2O5S2/c1-31-19-6-4-5-16(23(19)33-3)24-17-11-14(26)7-9-18(17)28-25(30)20(35-24)12-21-27-13-15(34-21)8-10-22(29)32-2/h4-7,9,11,13,20,24H,8,10,12H2,1-3H3,(H,28,30)/t20-,24-/m0/s1 |
| InChIKey | RWVXUYGXUPKLMQ-RDPSFJRHSA-N |
| XLogP | 5.31 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |