C25H27ClN4O4S2 — CID 68921269
methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate (PubChem CID 68921269) has the molecular formula C25H27ClN4O4S2 and a molecular weight of 547.10 g/mol. Its IUPAC name is methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate.
| Compound Name | methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 68921269 |
| Molecular Formula | C25H27ClN4O4S2 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | methyl 3-[2-[[(3S,5R)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]methyl]-1,3-thiazol-5-yl]propanoate |
| SMILES | COC(=O)CCc1cnc(C[C@@H]2S[C@@H](c3cccc(OC)c3OC)c3cc(Cl)ccc3N=C2NN)s1 |
| InChI | InChI=1S/C25H27ClN4O4S2/c1-32-19-6-4-5-16(23(19)34-3)24-17-11-14(26)7-9-18(17)29-25(30-27)20(36-24)12-21-28-13-15(35-21)8-10-22(31)33-2/h4-7,9,11,13,20,24H,8,10,12,27H2,1-3H3,(H,29,30)/t20-,24-/m0/s1 |
| InChIKey | GAFNLIQUUGLRHN-RDPSFJRHSA-N |
| XLogP | 4.86 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|