C28H30ClN2O7S- — CID 59805606
2-[2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazol-5-yl]acetate (PubChem CID 59805606) has the molecular formula C28H30ClN2O7S- and a molecular weight of 574.08 g/mol. Its IUPAC name is 2-[2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazol-5-yl]acetate.
| Compound Name | 2-[2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 59805606 |
| Molecular Formula | C28H30ClN2O7S- |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2-[2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazol-5-yl]acetate |
| SMILES | COc1cccc([C@H]2O[C@H](Cc3ncc(CC(=O)[O-])s3)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C28H31ClN2O7S/c1-28(2,15-32)14-31-20-9-8-16(29)10-19(20)25(18-6-5-7-21(36-3)26(18)37-4)38-22(27(31)35)12-23-30-13-17(39-23)11-24(33)34/h5-10,13,22,25,32H,11-12,14-15H2,1-4H3,(H,33,34)/p-1/t22-,25-/m1/s1 |
| InChIKey | WAAVPQWPKQGTEZ-RCZVLFRGSA-M |
| XLogP | 3.19 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |