C19H20ClN3O4S — CID 68919343
2-[7-chloro-5-(2,6-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]acetic acid (PubChem CID 68919343) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 2-[7-chloro-5-(2,6-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]acetic acid.
| Compound Name | 2-[7-chloro-5-(2,6-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]acetic acid |
|---|---|
| PubChem CID | 68919343 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[7-chloro-5-(2,6-dimethoxyphenyl)-2-hydrazinyl-3,5-dihydro-4,1-benzothiazepin-3-yl]acetic acid |
| SMILES | COc1cccc(OC)c1C1SC(CC(=O)O)C(NN)=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-26-13-4-3-5-14(27-2)17(13)18-11-8-10(20)6-7-12(11)22-19(23-21)15(28-18)9-16(24)25/h3-8,15,18H,9,21H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | OSCQQFFIIDIXKY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|