C21H17ClF3N3O4S — CID 68916355
2-[(4S,6R)-8-chloro-6-(2,6-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetic acid (PubChem CID 68916355) has the molecular formula C21H17ClF3N3O4S and a molecular weight of 499.90 g/mol. Its IUPAC name is 2-[(4S,6R)-8-chloro-6-(2,6-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetic acid.
| Compound Name | 2-[(4S,6R)-8-chloro-6-(2,6-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetic acid |
|---|---|
| PubChem CID | 68916355 |
| Molecular Formula | C21H17ClF3N3O4S |
| Molecular Weight | 499.90 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-[(4S,6R)-8-chloro-6-(2,6-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetic acid |
| SMILES | COc1cccc(OC)c1[C@@H]1S[C@@H](CC(=O)O)c2nnc(C(F)(F)F)n2-c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H17ClF3N3O4S/c1-31-13-4-3-5-14(32-2)17(13)18-11-8-10(22)6-7-12(11)28-19(15(33-18)9-16(29)30)26-27-20(28)21(23,24)25/h3-8,15,18H,9H2,1-2H3,(H,29,30)/t15-,18+/m0/s1 |
| InChIKey | DJYCIUNKQDHJGH-MAUKXSAKSA-N |
| XLogP | 5.31 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.90 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |