C24H23ClF3N3O3S — CID 68922314
propan-2-yl 2-[8-chloro-6-(3-methoxy-2-methylphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate (PubChem CID 68922314) has the molecular formula C24H23ClF3N3O3S and a molecular weight of 525.98 g/mol. Its IUPAC name is propan-2-yl 2-[8-chloro-6-(3-methoxy-2-methylphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate.
| Compound Name | propan-2-yl 2-[8-chloro-6-(3-methoxy-2-methylphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate |
|---|---|
| PubChem CID | 68922314 |
| Molecular Formula | C24H23ClF3N3O3S |
| Molecular Weight | 525.98 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | propan-2-yl 2-[8-chloro-6-(3-methoxy-2-methylphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate |
| SMILES | COc1cccc(C2SC(CC(=O)OC(C)C)c3nnc(C(F)(F)F)n3-c3ccc(Cl)cc32)c1C |
| InChI | InChI=1S/C24H23ClF3N3O3S/c1-12(2)34-20(32)11-19-22-29-30-23(24(26,27)28)31(22)17-9-8-14(25)10-16(17)21(35-19)15-6-5-7-18(33-4)13(15)3/h5-10,12,19,21H,11H2,1-4H3 |
| InChIKey | AABIQOYYRQOVPR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.98 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |