C22H21ClF3N3O5S2 — CID 87623086
2-[(4S,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]ethyl methanesulfonate (PubChem CID 87623086) has the molecular formula C22H21ClF3N3O5S2 and a molecular weight of 564.01 g/mol. Its IUPAC name is 2-[(4S,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[(4S,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 87623086 |
| Molecular Formula | C22H21ClF3N3O5S2 |
| Molecular Weight | 564.01 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | 2-[(4S,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]ethyl methanesulfonate |
| SMILES | COc1cccc([C@@H]2S[C@@H](CCOS(C)(=O)=O)c3nnc(C(F)(F)F)n3-c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C22H21ClF3N3O5S2/c1-32-16-6-4-5-13(18(16)33-2)19-14-11-12(23)7-8-15(14)29-20(27-28-21(29)22(24,25)26)17(35-19)9-10-34-36(3,30)31/h4-8,11,17,19H,9-10H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | YJCJQPGLSPHGJV-HKUYNNGSSA-N |
| XLogP | 5.20 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.01 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|