C21H17ClF3N3O4 — CID 68919037
(4R,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepine-4-carboxylic acid (PubChem CID 68919037) has the molecular formula C21H17ClF3N3O4 and a molecular weight of 467.83 g/mol. Its IUPAC name is (4R,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepine-4-carboxylic acid.
| Compound Name | (4R,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 68919037 |
| Molecular Formula | C21H17ClF3N3O4 |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | (4R,6R)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1]benzazepine-4-carboxylic acid |
| SMILES | COc1cccc([C@@H]2C[C@@H](C(=O)O)c3nnc(C(F)(F)F)n3-c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C21H17ClF3N3O4/c1-31-16-5-3-4-11(17(16)32-2)12-9-14(19(29)30)18-26-27-20(21(23,24)25)28(18)15-7-6-10(22)8-13(12)15/h3-8,12,14H,9H2,1-2H3,(H,29,30)/t12-,14+/m0/s1 |
| InChIKey | VVRZNGUEPMJKTG-GXTWGEPZSA-N |
| XLogP | 4.66 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |