C25H25ClF3N3O5S — CID 68920014
propan-2-yl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate (PubChem CID 68920014) has the molecular formula C25H25ClF3N3O5S and a molecular weight of 572.01 g/mol. Its IUPAC name is propan-2-yl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate.
| Compound Name | propan-2-yl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate |
|---|---|
| PubChem CID | 68920014 |
| Molecular Formula | C25H25ClF3N3O5S |
| Molecular Weight | 572.01 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | propan-2-yl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzothiazepin-4-yl]acetate |
| SMILES | COc1cccc(C2SC(CC(=O)OC(C)C)c3nnc(C(F)(F)F)n3-c3c(OC)cc(Cl)cc32)c1OC |
| InChI | InChI=1S/C25H25ClF3N3O5S/c1-12(2)37-19(33)11-18-23-30-31-24(25(27,28)29)32(23)20-15(9-13(26)10-17(20)35-4)22(38-18)14-7-6-8-16(34-3)21(14)36-5/h6-10,12,18,22H,11H2,1-5H3 |
| InChIKey | IRJHDSCLHOKDNW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.01 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |