C24H23ClF3N3O6 — CID 68922467
ethyl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate (PubChem CID 68922467) has the molecular formula C24H23ClF3N3O6 and a molecular weight of 541.91 g/mol. Its IUPAC name is ethyl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate.
| Compound Name | ethyl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
|---|---|
| PubChem CID | 68922467 |
| Molecular Formula | C24H23ClF3N3O6 |
| Molecular Weight | 541.91 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | ethyl 2-[8-chloro-6-(2,3-dimethoxyphenyl)-10-methoxy-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
| SMILES | CCOC(=O)CC1OC(c2cccc(OC)c2OC)c2cc(Cl)cc(OC)c2-n2c1nnc2C(F)(F)F |
| InChI | InChI=1S/C24H23ClF3N3O6/c1-5-36-18(32)11-17-22-29-30-23(24(26,27)28)31(22)19-14(9-12(25)10-16(19)34-3)20(37-17)13-7-6-8-15(33-2)21(13)35-4/h6-10,17,20H,5,11H2,1-4H3 |
| InChIKey | WCVVLHRCKOTYCY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.91 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |