C24H22F5N3O5 — CID 68916836
ethyl 2-[1-(difluoromethyl)-6-(2,3-dimethoxyphenyl)-8-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate (PubChem CID 68916836) has the molecular formula C24H22F5N3O5 and a molecular weight of 527.45 g/mol. Its IUPAC name is ethyl 2-[1-(difluoromethyl)-6-(2,3-dimethoxyphenyl)-8-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate.
| Compound Name | ethyl 2-[1-(difluoromethyl)-6-(2,3-dimethoxyphenyl)-8-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
|---|---|
| PubChem CID | 68916836 |
| Molecular Formula | C24H22F5N3O5 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | ethyl 2-[1-(difluoromethyl)-6-(2,3-dimethoxyphenyl)-8-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
| SMILES | CCOC(=O)CC1OC(c2cccc(OC)c2OC)c2cc(C(F)(F)F)ccc2-n2c(C(F)F)nnc21 |
| InChI | InChI=1S/C24H22F5N3O5/c1-4-36-18(33)11-17-22-30-31-23(21(25)26)32(22)15-9-8-12(24(27,28)29)10-14(15)19(37-17)13-6-5-7-16(34-2)20(13)35-3/h5-10,17,19,21H,4,11H2,1-3H3 |
| InChIKey | NNQQVXREYDYOTQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |