C22H18Cl3F2N3O4 — CID 68924349
ethyl 2-[8-chloro-1-[chloro(difluoro)methyl]-6-(2-chloro-3-methoxyphenyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate (PubChem CID 68924349) has the molecular formula C22H18Cl3F2N3O4 and a molecular weight of 532.76 g/mol. Its IUPAC name is ethyl 2-[8-chloro-1-[chloro(difluoro)methyl]-6-(2-chloro-3-methoxyphenyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate.
| Compound Name | ethyl 2-[8-chloro-1-[chloro(difluoro)methyl]-6-(2-chloro-3-methoxyphenyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
|---|---|
| PubChem CID | 68924349 |
| Molecular Formula | C22H18Cl3F2N3O4 |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | ethyl 2-[8-chloro-1-[chloro(difluoro)methyl]-6-(2-chloro-3-methoxyphenyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
| SMILES | CCOC(=O)CC1OC(c2cccc(OC)c2Cl)c2cc(Cl)ccc2-n2c1nnc2C(F)(F)Cl |
| InChI | InChI=1S/C22H18Cl3F2N3O4/c1-3-33-17(31)10-16-20-28-29-21(22(25,26)27)30(20)14-8-7-11(23)9-13(14)19(34-16)12-5-4-6-15(32-2)18(12)24/h4-9,16,19H,3,10H2,1-2H3 |
| InChIKey | WFHAXYCVBNPJRM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|