C22H20F3N3O4 — CID 68919098
2-[6-(3-methoxy-2-methylphenyl)-8-methyl-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetic acid (PubChem CID 68919098) has the molecular formula C22H20F3N3O4 and a molecular weight of 447.41 g/mol. Its IUPAC name is 2-[6-(3-methoxy-2-methylphenyl)-8-methyl-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetic acid.
| Compound Name | 2-[6-(3-methoxy-2-methylphenyl)-8-methyl-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetic acid |
|---|---|
| PubChem CID | 68919098 |
| Molecular Formula | C22H20F3N3O4 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[6-(3-methoxy-2-methylphenyl)-8-methyl-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetic acid |
| SMILES | COc1cccc(C2OC(CC(=O)O)c3nnc(C(F)(F)F)n3-c3ccc(C)cc32)c1C |
| InChI | InChI=1S/C22H20F3N3O4/c1-11-7-8-15-14(9-11)19(13-5-4-6-16(31-3)12(13)2)32-17(10-18(29)30)20-26-27-21(28(15)20)22(23,24)25/h4-9,17,19H,10H2,1-3H3,(H,29,30) |
| InChIKey | ISNYUPIDEIXEJP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |