C28H29ClF3N3O8 — CID 68919081
ethyl 2-[10-(3-acetyloxypropoxy)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate (PubChem CID 68919081) has the molecular formula C28H29ClF3N3O8 and a molecular weight of 628.00 g/mol. Its IUPAC name is ethyl 2-[10-(3-acetyloxypropoxy)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate.
| Compound Name | ethyl 2-[10-(3-acetyloxypropoxy)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
|---|---|
| PubChem CID | 68919081 |
| Molecular Formula | C28H29ClF3N3O8 |
| Molecular Weight | 628.00 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | ethyl 2-[10-(3-acetyloxypropoxy)-8-chloro-6-(2,3-dimethoxyphenyl)-1-(trifluoromethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][4,1]benzoxazepin-4-yl]acetate |
| SMILES | CCOC(=O)CC1OC(c2cccc(OC)c2OC)c2cc(Cl)cc(OCCCOC(C)=O)c2-n2c1nnc2C(F)(F)F |
| InChI | InChI=1S/C28H29ClF3N3O8/c1-5-40-22(37)14-21-26-33-34-27(28(30,31)32)35(26)23-18(12-16(29)13-20(23)42-11-7-10-41-15(2)36)24(43-21)17-8-6-9-19(38-3)25(17)39-4/h6,8-9,12-13,21,24H,5,7,10-11,14H2,1-4H3 |
| InChIKey | AUDLQLCYOBIFPY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 120.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.00 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|