C26H30ClNO9 — CID 68920363
ethyl 2-[9-(3-acetyloxypropoxy)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzoxazepin-3-yl]acetate (PubChem CID 68920363) has the molecular formula C26H30ClNO9 and a molecular weight of 535.98 g/mol. Its IUPAC name is ethyl 2-[9-(3-acetyloxypropoxy)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzoxazepin-3-yl]acetate.
| Compound Name | ethyl 2-[9-(3-acetyloxypropoxy)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzoxazepin-3-yl]acetate |
|---|---|
| PubChem CID | 68920363 |
| Molecular Formula | C26H30ClNO9 |
| Molecular Weight | 535.98 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | ethyl 2-[9-(3-acetyloxypropoxy)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-1,5-dihydro-4,1-benzoxazepin-3-yl]acetate |
| SMILES | CCOC(=O)CC1OC(c2cccc(OC)c2OC)c2cc(Cl)cc(OCCCOC(C)=O)c2NC1=O |
| InChI | InChI=1S/C26H30ClNO9/c1-5-34-22(30)14-21-26(31)28-23-18(12-16(27)13-20(23)36-11-7-10-35-15(2)29)24(37-21)17-8-6-9-19(32-3)25(17)33-4/h6,8-9,12-13,21,24H,5,7,10-11,14H2,1-4H3,(H,28,31) |
| InChIKey | PTVCSKUQWHAAAA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.98 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|