C18H15ClFNO4S — CID 69155873
2-[7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-oxo-4,5-dihydro-3H-1,4-benzothiazepin-3-yl]acetic acid (PubChem CID 69155873) has the molecular formula C18H15ClFNO4S and a molecular weight of 395.84 g/mol. Its IUPAC name is 2-[7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-oxo-4,5-dihydro-3H-1,4-benzothiazepin-3-yl]acetic acid.
| Compound Name | 2-[7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-oxo-4,5-dihydro-3H-1,4-benzothiazepin-3-yl]acetic acid |
|---|---|
| PubChem CID | 69155873 |
| Molecular Formula | C18H15ClFNO4S |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[7-chloro-5-(2-fluoro-3-methoxyphenyl)-2-oxo-4,5-dihydro-3H-1,4-benzothiazepin-3-yl]acetic acid |
| SMILES | COc1cccc(C2NC(CC(=O)O)C(=O)Sc3ccc(Cl)cc32)c1F |
| InChI | InChI=1S/C18H15ClFNO4S/c1-25-13-4-2-3-10(16(13)20)17-11-7-9(19)5-6-14(11)26-18(24)12(21-17)8-15(22)23/h2-7,12,17,21H,8H2,1H3,(H,22,23) |
| InChIKey | NJOLLUWYKBMVQK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|