C23H28ClN3O5S — CID 68916831
2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-9-methoxy-3,5-dihydro-4,1-benzothiazepin-3-yl]-3-methylbutanoic acid (PubChem CID 68916831) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is 2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-9-methoxy-3,5-dihydro-4,1-benzothiazepin-3-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-9-methoxy-3,5-dihydro-4,1-benzothiazepin-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 68916831 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-2-hydrazinyl-9-methoxy-3,5-dihydro-4,1-benzothiazepin-3-yl]-3-methylbutanoic acid |
| SMILES | COc1cc(Cl)cc2c1N=C(NN)[C@H](C(C(=O)O)C(C)C)S[C@@H]2c1cccc(OC)c1OC |
| InChI | InChI=1S/C23H28ClN3O5S/c1-11(2)17(23(28)29)21-22(27-25)26-18-14(9-12(24)10-16(18)31-4)20(33-21)13-7-6-8-15(30-3)19(13)32-5/h6-11,17,20-21H,25H2,1-5H3,(H,26,27)(H,28,29)/t17?,20-,21+/m1/s1 |
| InChIKey | VHHCTTHJYKYRAB-SJRAPUSDSA-N |
| XLogP | 4.42 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|