C18H13F3IN3O — CID 68916025
N-[3-imidazol-1-yl-5-(trifluoromethyl)phenyl]-3-iodo-2-methylbenzamide (PubChem CID 68916025) has the molecular formula C18H13F3IN3O and a molecular weight of 471.22 g/mol. Its IUPAC name is N-[3-imidazol-1-yl-5-(trifluoromethyl)phenyl]-3-iodo-2-methylbenzamide.
| Compound Name | N-[3-imidazol-1-yl-5-(trifluoromethyl)phenyl]-3-iodo-2-methylbenzamide |
|---|---|
| PubChem CID | 68916025 |
| Molecular Formula | C18H13F3IN3O |
| Molecular Weight | 471.22 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | N-[3-imidazol-1-yl-5-(trifluoromethyl)phenyl]-3-iodo-2-methylbenzamide |
| SMILES | Cc1c(I)cccc1C(=O)Nc1cc(-n2ccnc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F3IN3O/c1-11-15(3-2-4-16(11)22)17(26)24-13-7-12(18(19,20)21)8-14(9-13)25-6-5-23-10-25/h2-10H,1H3,(H,24,26) |
| InChIKey | WXVQOFRQGHGGPL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|