C11H12ClNO4 — CID 68917619
(2R,3S)-3-acetamido-3-(2-chlorophenyl)-2-hydroxypropanoic acid (PubChem CID 68917619) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is (2R,3S)-3-acetamido-3-(2-chlorophenyl)-2-hydroxypropanoic acid.
| Compound Name | (2R,3S)-3-acetamido-3-(2-chlorophenyl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 68917619 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (2R,3S)-3-acetamido-3-(2-chlorophenyl)-2-hydroxypropanoic acid |
| SMILES | CC(=O)N[C@@H](c1ccccc1Cl)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C11H12ClNO4/c1-6(14)13-9(10(15)11(16)17)7-4-2-3-5-8(7)12/h2-5,9-10,15H,1H3,(H,13,14)(H,16,17)/t9-,10+/m0/s1 |
| InChIKey | SYYFLKYZVWPQTL-VHSXEESVSA-N |
| XLogP | 0.96 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |