C23H23ClN6O4 — CID 6891887
1-[(3-chlorophenyl)methyl]-8-[(2E)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 6891887) has the molecular formula C23H23ClN6O4 and a molecular weight of 482.93 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-8-[(2E)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(3-chlorophenyl)methyl]-8-[(2E)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 6891887 |
| Molecular Formula | C23H23ClN6O4 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-8-[(2E)-2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(/C=N/Nc2nc3c(c(=O)n(Cc4cccc(Cl)c4)c(=O)n3C)n2C)c(OC)c1 |
| InChI | InChI=1S/C23H23ClN6O4/c1-28-19-20(26-22(28)27-25-12-15-8-9-17(33-3)11-18(15)34-4)29(2)23(32)30(21(19)31)13-14-6-5-7-16(24)10-14/h5-12H,13H2,1-4H3,(H,26,27)/b25-12+ |
| InChIKey | FVJIWGRPVDCWCN-BRJLIKDPSA-N |
| XLogP | 2.60 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|