C9H21N3 — CID 68919851
4-piperidin-1-ylbutane-1,2-diamine (PubChem CID 68919851) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 4-piperidin-1-ylbutane-1,2-diamine.
| Compound Name | 4-piperidin-1-ylbutane-1,2-diamine |
|---|---|
| PubChem CID | 68919851 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 4-piperidin-1-ylbutane-1,2-diamine |
| SMILES | NCC(N)CCN1CCCCC1 |
| InChI | InChI=1S/C9H21N3/c10-8-9(11)4-7-12-5-2-1-3-6-12/h9H,1-8,10-11H2 |
| InChIKey | YVBIFLNRDLPGPV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |