C8H19N3O — CID 154463097
4-morpholin-4-ylbutane-1,2-diamine (PubChem CID 154463097) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-morpholin-4-ylbutane-1,2-diamine.
| Compound Name | 4-morpholin-4-ylbutane-1,2-diamine |
|---|---|
| PubChem CID | 154463097 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 4-morpholin-4-ylbutane-1,2-diamine |
| SMILES | NCC(N)CCN1CCOCC1 |
| InChI | InChI=1S/C8H19N3O/c9-7-8(10)1-2-11-3-5-12-6-4-11/h8H,1-7,9-10H2 |
| InChIKey | HCUFJAZYCMLIKX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |