C7H17N3O — CID 50989617
(2R)-3-morpholin-4-ylpropane-1,2-diamine (PubChem CID 50989617) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is (2R)-3-morpholin-4-ylpropane-1,2-diamine.
| Compound Name | (2R)-3-morpholin-4-ylpropane-1,2-diamine |
|---|---|
| PubChem CID | 50989617 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (2R)-3-morpholin-4-ylpropane-1,2-diamine |
| SMILES | NC[C@@H](N)CN1CCOCC1 |
| InChI | InChI=1S/C7H17N3O/c8-5-7(9)6-10-1-3-11-4-2-10/h7H,1-6,8-9H2/t7-/m1/s1 |
| InChIKey | IKWUDGJEJWHICW-SSDOTTSWSA-N |
| XLogP | -1.40 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |