C21H21F2NO5 — CID 68921762
but-2-enedioic acid;(3R)-3-[[2-(2,4-difluorophenyl)phenyl]methoxy]pyrrolidine (PubChem CID 68921762) has the molecular formula C21H21F2NO5 and a molecular weight of 405.40 g/mol. Its IUPAC name is but-2-enedioic acid;(3R)-3-[[2-(2,4-difluorophenyl)phenyl]methoxy]pyrrolidine.
| Compound Name | but-2-enedioic acid;(3R)-3-[[2-(2,4-difluorophenyl)phenyl]methoxy]pyrrolidine |
|---|---|
| PubChem CID | 68921762 |
| Molecular Formula | C21H21F2NO5 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | but-2-enedioic acid;(3R)-3-[[2-(2,4-difluorophenyl)phenyl]methoxy]pyrrolidine |
| SMILES | Fc1ccc(-c2ccccc2CO[C@@H]2CCNC2)c(F)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H17F2NO.C4H4O4/c18-13-5-6-16(17(19)9-13)15-4-2-1-3-12(15)11-21-14-7-8-20-10-14;5-3(6)1-2-4(7)8/h1-6,9,14,20H,7-8,10-11H2;1-2H,(H,5,6)(H,7,8)/t14-;/m1./s1 |
| InChIKey | VXVRZMHMSSJNJK-PFEQFJNWSA-N |
| XLogP | 3.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|