C18H30O6 — CID 68922909
[2-cyclobutyl-2-(hydroxymethyl)cyclobutyl]methanol;bis(2-methylprop-2-enoic acid) (PubChem CID 68922909) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [2-cyclobutyl-2-(hydroxymethyl)cyclobutyl]methanol;bis(2-methylprop-2-enoic acid).
| Compound Name | [2-cyclobutyl-2-(hydroxymethyl)cyclobutyl]methanol;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 68922909 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [2-cyclobutyl-2-(hydroxymethyl)cyclobutyl]methanol;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.OCC1CCC1(CO)C1CCC1 |
| InChI | InChI=1S/C10H18O2.2C4H6O2/c11-6-9-4-5-10(9,7-12)8-2-1-3-8;2*1-3(2)4(5)6/h8-9,11-12H,1-7H2;2*1H2,2H3,(H,5,6) |
| InChIKey | CXZPECCXUNJFCB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|