C21H17ClFNO4 — CID 68925792
(E)-3-[1-[4-chloro-2-[(2-fluoro-3-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoic acid (PubChem CID 68925792) has the molecular formula C21H17ClFNO4 and a molecular weight of 401.82 g/mol. Its IUPAC name is (E)-3-[1-[4-chloro-2-[(2-fluoro-3-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[4-chloro-2-[(2-fluoro-3-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68925792 |
| Molecular Formula | C21H17ClFNO4 |
| Molecular Weight | 401.82 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | (E)-3-[1-[4-chloro-2-[(2-fluoro-3-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoic acid |
| SMILES | COc1cccc(C(O)c2cc(Cl)ccc2-n2cccc2/C=C/C(=O)O)c1F |
| InChI | InChI=1S/C21H17ClFNO4/c1-28-18-6-2-5-15(20(18)23)21(27)16-12-13(22)7-9-17(16)24-11-3-4-14(24)8-10-19(25)26/h2-12,21,27H,1H3,(H,25,26)/b10-8+ |
| InChIKey | BLYLDUYNMSTUDL-CSKARUKUSA-N |
| XLogP | 4.46 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|