C22H19ClFNO4 — CID 76602853
methyl 3-[1-[4-chloro-2-[(3-fluoro-2-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoate (PubChem CID 76602853) has the molecular formula C22H19ClFNO4 and a molecular weight of 415.85 g/mol. Its IUPAC name is methyl 3-[1-[4-chloro-2-[(3-fluoro-2-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[1-[4-chloro-2-[(3-fluoro-2-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 76602853 |
| Molecular Formula | C22H19ClFNO4 |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | methyl 3-[1-[4-chloro-2-[(3-fluoro-2-methoxyphenyl)-hydroxymethyl]phenyl]pyrrol-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cccn1-c1ccc(Cl)cc1C(O)c1cccc(F)c1OC |
| InChI | InChI=1S/C22H19ClFNO4/c1-28-20(26)11-9-15-5-4-12-25(15)19-10-8-14(23)13-17(19)21(27)16-6-3-7-18(24)22(16)29-2/h3-13,21,27H,1-2H3 |
| InChIKey | RZLLPTJYKZBRGN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|