C15H13Cl2NO4 — CID 68918668
[4-chloro-2-[(3-chloro-2-methoxyphenyl)-hydroxymethyl]phenyl]carbamic acid (PubChem CID 68918668) has the molecular formula C15H13Cl2NO4 and a molecular weight of 342.18 g/mol. Its IUPAC name is [4-chloro-2-[(3-chloro-2-methoxyphenyl)-hydroxymethyl]phenyl]carbamic acid.
| Compound Name | [4-chloro-2-[(3-chloro-2-methoxyphenyl)-hydroxymethyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 68918668 |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | [4-chloro-2-[(3-chloro-2-methoxyphenyl)-hydroxymethyl]phenyl]carbamic acid |
| SMILES | COc1c(Cl)cccc1C(O)c1cc(Cl)ccc1NC(=O)O |
| InChI | InChI=1S/C15H13Cl2NO4/c1-22-14-9(3-2-4-11(14)17)13(19)10-7-8(16)5-6-12(10)18-15(20)21/h2-7,13,18-19H,1H3,(H,20,21) |
| InChIKey | ITTNYPPKQDVYOU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |