C22H19ClN2O5 — CID 76602958
methyl 3-[1-[4-chloro-2-(3,4-dimethoxypyridine-2-carbonyl)phenyl]pyrrol-2-yl]prop-2-enoate (PubChem CID 76602958) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is methyl 3-[1-[4-chloro-2-(3,4-dimethoxypyridine-2-carbonyl)phenyl]pyrrol-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[1-[4-chloro-2-(3,4-dimethoxypyridine-2-carbonyl)phenyl]pyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 76602958 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | methyl 3-[1-[4-chloro-2-(3,4-dimethoxypyridine-2-carbonyl)phenyl]pyrrol-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cccn1-c1ccc(Cl)cc1C(=O)c1nccc(OC)c1OC |
| InChI | InChI=1S/C22H19ClN2O5/c1-28-18-10-11-24-20(22(18)30-3)21(27)16-13-14(23)6-8-17(16)25-12-4-5-15(25)7-9-19(26)29-2/h4-13H,1-3H3 |
| InChIKey | DFHGRXXKIQWNFQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|