C24H34FNO8S — CID 68927802
(2S,3S)-8-[(4-fluoro-2-heptylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid (PubChem CID 68927802) has the molecular formula C24H34FNO8S and a molecular weight of 515.60 g/mol. Its IUPAC name is (2S,3S)-8-[(4-fluoro-2-heptylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid.
| Compound Name | (2S,3S)-8-[(4-fluoro-2-heptylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 68927802 |
| Molecular Formula | C24H34FNO8S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | (2S,3S)-8-[(4-fluoro-2-heptylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid |
| SMILES | CCCCCCCc1cc(F)ccc1NS(=O)(=O)C1CCC2(C=C1C(=O)O)O[C@@H](CO)[C@H](CO)O2 |
| InChI | InChI=1S/C24H34FNO8S/c1-2-3-4-5-6-7-16-12-17(25)8-9-19(16)26-35(31,32)22-10-11-24(13-18(22)23(29)30)33-20(14-27)21(15-28)34-24/h8-9,12-13,20-22,26-28H,2-7,10-11,14-15H2,1H3,(H,29,30)/t20-,21-,22?/m0/s1 |
| InChIKey | BQWWKIXFAFBUMG-LGTSYYJHSA-N |
| XLogP | 2.72 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|