C15H18FNO4S — CID 142066456
6-[(2-ethyl-4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylic acid (PubChem CID 142066456) has the molecular formula C15H18FNO4S and a molecular weight of 327.38 g/mol. Its IUPAC name is 6-[(2-ethyl-4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylic acid.
| Compound Name | 6-[(2-ethyl-4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 142066456 |
| Molecular Formula | C15H18FNO4S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 6-[(2-ethyl-4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylic acid |
| SMILES | CCc1cc(F)ccc1NS(=O)(=O)C1CCCC=C1C(=O)O |
| InChI | InChI=1S/C15H18FNO4S/c1-2-10-9-11(16)7-8-13(10)17-22(20,21)14-6-4-3-5-12(14)15(18)19/h5,7-9,14,17H,2-4,6H2,1H3,(H,18,19) |
| InChIKey | RLYGWUVPHGYLEW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |