C15H19F2NO2S — CID 141012068
N-(2,4-difluorophenyl)-2-propan-2-ylcyclohex-2-ene-1-sulfonamide (PubChem CID 141012068) has the molecular formula C15H19F2NO2S and a molecular weight of 315.38 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-propan-2-ylcyclohex-2-ene-1-sulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-2-propan-2-ylcyclohex-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 141012068 |
| Molecular Formula | C15H19F2NO2S |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-propan-2-ylcyclohex-2-ene-1-sulfonamide |
| SMILES | CC(C)C1=CCCCC1S(=O)(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H19F2NO2S/c1-10(2)12-5-3-4-6-15(12)21(19,20)18-14-8-7-11(16)9-13(14)17/h5,7-10,15,18H,3-4,6H2,1-2H3 |
| InChIKey | OOANODGCCAHLMR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|