About 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid
6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid (PubChem CID 123452368) has the molecular formula C11H12Br2N2O4S
and a molecular weight of 428.10 g/mol. Its IUPAC name is 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid |
| PubChem CID | 123452368 |
| Molecular Formula | C11H12Br2N2O4S |
| Molecular Weight | 428.10 g/mol |
| Exact Mass | 425.89 |
| IUPAC Name | 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid |
| SMILES | O=C(O)C1=CCCCC1S(=O)(=O)Nn1c(Br)ccc1Br |
| InChI | InChI=1S/C11H12Br2N2O4S/c12-9-5-6-10(13)15(9)14-20(18,19)8-4-2-1-3-7(8)11(16)17/h3,5-6,8,14H,1-2,4H2,(H,16,17) |
| InChIKey | OCAWFRSFBXJIBS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid?
The IUPAC name of 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid (CID 123452368) is 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid.
What is the SMILES notation for 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid?
The canonical SMILES for 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid is O=C(O)C1=CCCCC1S(=O)(=O)Nn1c(Br)ccc1Br.
What is the InChIKey of 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid?
The InChIKey is OCAWFRSFBXJIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Br2N2O4S/c12-9-5-6-10(13)15(9)14-20(18,19)8-4-2-1-3-7(8)11(16)17/h3,5-6,8,14H,1-2,4H2,(H,16,17).
What are the key properties of 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid?
6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid has a molecular weight of 428.10 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,5-dibromopyrrol-1-yl)sulfamoyl]cyclohexene-1-carboxylic acid is sourced from PubChem (CID 123452368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).