C14H14F3NO5S — CID 150523334
6-[[2-(trifluoromethoxy)phenyl]sulfamoyl]cyclohexene-1-carboxylic acid (PubChem CID 150523334) has the molecular formula C14H14F3NO5S and a molecular weight of 365.33 g/mol. Its IUPAC name is 6-[[2-(trifluoromethoxy)phenyl]sulfamoyl]cyclohexene-1-carboxylic acid.
| Compound Name | 6-[[2-(trifluoromethoxy)phenyl]sulfamoyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 150523334 |
| Molecular Formula | C14H14F3NO5S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 6-[[2-(trifluoromethoxy)phenyl]sulfamoyl]cyclohexene-1-carboxylic acid |
| SMILES | O=C(O)C1=CCCCC1S(=O)(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H14F3NO5S/c15-14(16,17)23-11-7-3-2-6-10(11)18-24(21,22)12-8-4-1-5-9(12)13(19)20/h2-3,5-7,12,18H,1,4,8H2,(H,19,20) |
| InChIKey | ICHMLMASGXOEFB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |