C12H13F3N2O4S — CID 90513254
1-methylsulfonyl-N-[2-(trifluoromethoxy)phenyl]azetidine-3-carboxamide (PubChem CID 90513254) has the molecular formula C12H13F3N2O4S and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[2-(trifluoromethoxy)phenyl]azetidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[2-(trifluoromethoxy)phenyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513254 |
| Molecular Formula | C12H13F3N2O4S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-methylsulfonyl-N-[2-(trifluoromethoxy)phenyl]azetidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CC(C(=O)Nc2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F3N2O4S/c1-22(19,20)17-6-8(7-17)11(18)16-9-4-2-3-5-10(9)21-12(13,14)15/h2-5,8H,6-7H2,1H3,(H,16,18) |
| InChIKey | FMLXSJZWRKMAFT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |