C24H23N7O — CID 68928690
3-[2-[6-(cyclopropylamino)purin-9-yl]ethenyl]-4-methyl-N-(4-methyl-2-pyridinyl)benzamide (PubChem CID 68928690) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is 3-[2-[6-(cyclopropylamino)purin-9-yl]ethenyl]-4-methyl-N-(4-methyl-2-pyridinyl)benzamide.
| Compound Name | 3-[2-[6-(cyclopropylamino)purin-9-yl]ethenyl]-4-methyl-N-(4-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 68928690 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 3-[2-[6-(cyclopropylamino)purin-9-yl]ethenyl]-4-methyl-N-(4-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1ccnc(NC(=O)c2ccc(C)c(C=Cn3cnc4c(NC5CC5)ncnc43)c2)c1 |
| InChI | InChI=1S/C24H23N7O/c1-15-7-9-25-20(11-15)30-24(32)18-4-3-16(2)17(12-18)8-10-31-14-28-21-22(29-19-5-6-19)26-13-27-23(21)31/h3-4,7-14,19H,5-6H2,1-2H3,(H,25,30,32)(H,26,27,29) |
| InChIKey | XNPDOWCNRVWKJZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |